C7H10ClN5 — CID 54353580
6-chloro-4-N-methyl-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 54353580) has the molecular formula C7H10ClN5 and a molecular weight of 199.65 g/mol. Its IUPAC name is 6-chloro-4-N-methyl-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-methyl-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 54353580 |
| Molecular Formula | C7H10ClN5 |
| Molecular Weight | 199.65 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 6-chloro-4-N-methyl-2-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Cl)nc(NC)n1 |
| InChI | InChI=1S/C7H10ClN5/c1-3-4-10-7-12-5(8)11-6(9-2)13-7/h3H,1,4H2,2H3,(H2,9,10,11,12,13) |
| InChIKey | UHNCVHQILABHQT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.65 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|