About 4-cyclohexylthiane
4-cyclohexylthiane (PubChem CID 543539) has the molecular formula C11H20S
and a molecular weight of 184.35 g/mol. Its IUPAC name is 4-cyclohexylthiane.
Molecular Properties
| Compound Name | 4-cyclohexylthiane |
| PubChem CID | 543539 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 4-cyclohexylthiane |
| SMILES | C1CCC(C2CCSCC2)CC1 |
| InChI | InChI=1S/C11H20S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h10-11H,1-9H2 |
| InChIKey | YQSCSIFOZPJIRG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylthiane?
The IUPAC name of 4-cyclohexylthiane (CID 543539) is 4-cyclohexylthiane.
What is the SMILES notation for 4-cyclohexylthiane?
The canonical SMILES for 4-cyclohexylthiane is C1CCC(C2CCSCC2)CC1.
What is the InChIKey of 4-cyclohexylthiane?
The InChIKey is YQSCSIFOZPJIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h10-11H,1-9H2.
What are the key properties of 4-cyclohexylthiane?
4-cyclohexylthiane has a molecular weight of 184.35 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylthiane is sourced from PubChem (CID 543539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).