About (3S)-3-azido-1,1-dimethylcyclopentane
(3S)-3-azido-1,1-dimethylcyclopentane (PubChem CID 54353995) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (3S)-3-azido-1,1-dimethylcyclopentane.
Molecular Properties
| Compound Name | (3S)-3-azido-1,1-dimethylcyclopentane |
| PubChem CID | 54353995 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (3S)-3-azido-1,1-dimethylcyclopentane |
| SMILES | CC1(C)CC[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C7H13N3/c1-7(2)4-3-6(5-7)9-10-8/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | YITGAILEMZJRHH-LURJTMIESA-N |
| XLogP | 2.88 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-azido-1,1-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-azido-1,1-dimethylcyclopentane?
The IUPAC name of (3S)-3-azido-1,1-dimethylcyclopentane (CID 54353995) is (3S)-3-azido-1,1-dimethylcyclopentane.
What is the SMILES notation for (3S)-3-azido-1,1-dimethylcyclopentane?
The canonical SMILES for (3S)-3-azido-1,1-dimethylcyclopentane is CC1(C)CC[C@H](N=[N+]=[N-])C1.
What is the InChIKey of (3S)-3-azido-1,1-dimethylcyclopentane?
The InChIKey is YITGAILEMZJRHH-LURJTMIESA-N. The full InChI is InChI=1S/C7H13N3/c1-7(2)4-3-6(5-7)9-10-8/h6H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of (3S)-3-azido-1,1-dimethylcyclopentane?
(3S)-3-azido-1,1-dimethylcyclopentane has a molecular weight of 139.20 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-azido-1,1-dimethylcyclopentane is sourced from PubChem (CID 54353995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).