About 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol
1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 54354216) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol |
| PubChem CID | 54354216 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1coc2c1=CCCC=2 |
| InChI | InChI=1S/C14H21NO3/c1-10(2)15-7-11(16)8-17-14-9-18-13-6-4-3-5-12(13)14/h5-6,9-11,15-16H,3-4,7-8H2,1-2H3 |
| InChIKey | UHYPPBDCMXZNRO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol?
The IUPAC name of 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol (CID 54354216) is 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol.
What is the SMILES notation for 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol?
The canonical SMILES for 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol is CC(C)NCC(O)COc1coc2c1=CCCC=2.
What is the InChIKey of 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol?
The InChIKey is UHYPPBDCMXZNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-10(2)15-7-11(16)8-17-14-9-18-13-6-4-3-5-12(13)14/h5-6,9-11,15-16H,3-4,7-8H2,1-2H3.
What are the key properties of 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol?
1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol has a molecular weight of 251.33 g/mol, XLogP of 0.37, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dihydro-1-benzofuran-3-yloxy)-3-(propan-2-ylamino)propan-2-ol is sourced from PubChem (CID 54354216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).