About 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine
2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine (PubChem CID 54354418) has the molecular formula C25H21N3O3S
and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 54354418 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine |
| SMILES | COc1ccc2cc(-c3nc4ccncc4[nH]3)cc(OCCS(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H21N3O3S/c1-30-19-8-7-17-13-18(25-27-22-9-10-26-16-23(22)28-25)14-24(21(17)15-19)31-11-12-32(29)20-5-3-2-4-6-20/h2-10,13-16H,11-12H2,1H3,(H,27,28) |
| InChIKey | UICIRMSDSMHAHK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine (CID 54354418) is 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine is COc1ccc2cc(-c3nc4ccncc4[nH]3)cc(OCCS(=O)c3ccccc3)c2c1.
What is the InChIKey of 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine?
The InChIKey is UICIRMSDSMHAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O3S/c1-30-19-8-7-17-13-18(25-27-22-9-10-26-16-23(22)28-25)14-24(21(17)15-19)31-11-12-32(29)20-5-3-2-4-6-20/h2-10,13-16H,11-12H2,1H3,(H,27,28).
What are the key properties of 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine?
2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine has a molecular weight of 443.53 g/mol, XLogP of 4.97, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(benzenesulfinyl)ethoxy]-6-methoxynaphthalen-2-yl]-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 54354418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).