About 5-fluoro-N'-methylpentanimidamide
5-fluoro-N'-methylpentanimidamide (PubChem CID 54354453) has the molecular formula C6H13FN2
and a molecular weight of 132.18 g/mol. Its IUPAC name is 5-fluoro-N'-methylpentanimidamide.
Molecular Properties
| Compound Name | 5-fluoro-N'-methylpentanimidamide |
| PubChem CID | 54354453 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | 5-fluoro-N'-methylpentanimidamide |
| SMILES | C/N=C(/N)CCCCF |
| InChI | InChI=1S/C6H13FN2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3,(H2,8,9) |
| InChIKey | ANQGBNGRGCFIMN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N'-methylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N'-methylpentanimidamide?
The IUPAC name of 5-fluoro-N'-methylpentanimidamide (CID 54354453) is 5-fluoro-N'-methylpentanimidamide.
What is the SMILES notation for 5-fluoro-N'-methylpentanimidamide?
The canonical SMILES for 5-fluoro-N'-methylpentanimidamide is C/N=C(/N)CCCCF.
What is the InChIKey of 5-fluoro-N'-methylpentanimidamide?
The InChIKey is ANQGBNGRGCFIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FN2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3,(H2,8,9).
What are the key properties of 5-fluoro-N'-methylpentanimidamide?
5-fluoro-N'-methylpentanimidamide has a molecular weight of 132.18 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N'-methylpentanimidamide is sourced from PubChem (CID 54354453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).