C18H28N2O5 — CID 54354546
[(1S,2R,4S,6S,10S)-7-(hexylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate (PubChem CID 54354546) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(1S,2R,4S,6S,10S)-7-(hexylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate.
| Compound Name | [(1S,2R,4S,6S,10S)-7-(hexylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 54354546 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [(1S,2R,4S,6S,10S)-7-(hexylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
| SMILES | CCCCCCNC(=O)C1=CO[C@@H](OC(=O)NC)[C@H]2[C@@H]1C[C@@H]1O[C@]21C |
| InChI | InChI=1S/C18H28N2O5/c1-4-5-6-7-8-20-15(21)12-10-23-16(24-17(22)19-3)14-11(12)9-13-18(14,2)25-13/h10-11,13-14,16H,4-9H2,1-3H3,(H,19,22)(H,20,21)/t11-,13+,14-,16+,18+/m1/s1 |
| InChIKey | UIEIERGOGPRCSY-OVIXYOJMSA-N |
| XLogP | 2.07 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|