C21H27F3N2O5 — CID 54354722
7-[5-hydroxy-2-oxo-3-[4-[3-(trifluoromethyl)phenoxy]butyl]-1H-imidazol-4-yl]heptanoic acid (PubChem CID 54354722) has the molecular formula C21H27F3N2O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is 7-[5-hydroxy-2-oxo-3-[4-[3-(trifluoromethyl)phenoxy]butyl]-1H-imidazol-4-yl]heptanoic acid.
| Compound Name | 7-[5-hydroxy-2-oxo-3-[4-[3-(trifluoromethyl)phenoxy]butyl]-1H-imidazol-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 54354722 |
| Molecular Formula | C21H27F3N2O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 7-[5-hydroxy-2-oxo-3-[4-[3-(trifluoromethyl)phenoxy]butyl]-1H-imidazol-4-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1c(O)[nH]c(=O)n1CCCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H27F3N2O5/c22-21(23,24)15-8-7-9-16(14-15)31-13-6-5-12-26-17(19(29)25-20(26)30)10-3-1-2-4-11-18(27)28/h7-9,14,29H,1-6,10-13H2,(H,25,30)(H,27,28) |
| InChIKey | UIHVAUMZALIDGN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|