About 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine
6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine (PubChem CID 54355118) has the molecular formula C11H17NS2
and a molecular weight of 227.40 g/mol. Its IUPAC name is 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine |
| PubChem CID | 54355118 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine |
| SMILES | CC1C=CC=C(C2SCCCS2)N1C |
| InChI | InChI=1S/C11H17NS2/c1-9-5-3-6-10(12(9)2)11-13-7-4-8-14-11/h3,5-6,9,11H,4,7-8H2,1-2H3 |
| InChIKey | UIORKJMNXYEHFU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine?
The IUPAC name of 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine (CID 54355118) is 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine.
What is the SMILES notation for 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine?
The canonical SMILES for 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine is CC1C=CC=C(C2SCCCS2)N1C.
What is the InChIKey of 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine?
The InChIKey is UIORKJMNXYEHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS2/c1-9-5-3-6-10(12(9)2)11-13-7-4-8-14-11/h3,5-6,9,11H,4,7-8H2,1-2H3.
What are the key properties of 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine?
6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine has a molecular weight of 227.40 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-dithian-2-yl)-1,2-dimethyl-2H-pyridine is sourced from PubChem (CID 54355118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).