About propan-2-yl 2-benzylsulfanylacetate
propan-2-yl 2-benzylsulfanylacetate (PubChem CID 54355165) has the molecular formula C12H16O2S
and a molecular weight of 224.32 g/mol. Its IUPAC name is propan-2-yl 2-benzylsulfanylacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-benzylsulfanylacetate |
| PubChem CID | 54355165 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | propan-2-yl 2-benzylsulfanylacetate |
| SMILES | CC(C)OC(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C12H16O2S/c1-10(2)14-12(13)9-15-8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | UIPPTDNVMXHXGV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-benzylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-benzylsulfanylacetate?
The IUPAC name of propan-2-yl 2-benzylsulfanylacetate (CID 54355165) is propan-2-yl 2-benzylsulfanylacetate.
What is the SMILES notation for propan-2-yl 2-benzylsulfanylacetate?
The canonical SMILES for propan-2-yl 2-benzylsulfanylacetate is CC(C)OC(=O)CSCc1ccccc1.
What is the InChIKey of propan-2-yl 2-benzylsulfanylacetate?
The InChIKey is UIPPTDNVMXHXGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S/c1-10(2)14-12(13)9-15-8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3.
What are the key properties of propan-2-yl 2-benzylsulfanylacetate?
propan-2-yl 2-benzylsulfanylacetate has a molecular weight of 224.32 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-benzylsulfanylacetate is sourced from PubChem (CID 54355165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).