About 3-oxopent-4-enyl 2-methylprop-2-enoate
3-oxopent-4-enyl 2-methylprop-2-enoate (PubChem CID 54355186) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-oxopent-4-enyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 3-oxopent-4-enyl 2-methylprop-2-enoate |
| PubChem CID | 54355186 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-oxopent-4-enyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C9H12O3/c1-4-8(10)5-6-12-9(11)7(2)3/h4H,1-2,5-6H2,3H3 |
| InChIKey | UIPXAHZROJKXQV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopent-4-enyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopent-4-enyl 2-methylprop-2-enoate?
The IUPAC name of 3-oxopent-4-enyl 2-methylprop-2-enoate (CID 54355186) is 3-oxopent-4-enyl 2-methylprop-2-enoate.
What is the SMILES notation for 3-oxopent-4-enyl 2-methylprop-2-enoate?
The canonical SMILES for 3-oxopent-4-enyl 2-methylprop-2-enoate is C=CC(=O)CCOC(=O)C(=C)C.
What is the InChIKey of 3-oxopent-4-enyl 2-methylprop-2-enoate?
The InChIKey is UIPXAHZROJKXQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-4-8(10)5-6-12-9(11)7(2)3/h4H,1-2,5-6H2,3H3.
What are the key properties of 3-oxopent-4-enyl 2-methylprop-2-enoate?
3-oxopent-4-enyl 2-methylprop-2-enoate has a molecular weight of 168.19 g/mol, XLogP of 1.25, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopent-4-enyl 2-methylprop-2-enoate is sourced from PubChem (CID 54355186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).