About 2-(N-azidoanilino)acetic acid
2-(N-azidoanilino)acetic acid (PubChem CID 54355465) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-(N-azidoanilino)acetic acid.
Molecular Properties
| Compound Name | 2-(N-azidoanilino)acetic acid |
| PubChem CID | 54355465 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-(N-azidoanilino)acetic acid |
| SMILES | [N-]=[N+]=NN(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C8H8N4O2/c9-10-11-12(6-8(13)14)7-4-2-1-3-5-7/h1-5H,6H2,(H,13,14) |
| InChIKey | UIUNLAIBCNKSTC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-azidoanilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-azidoanilino)acetic acid?
The IUPAC name of 2-(N-azidoanilino)acetic acid (CID 54355465) is 2-(N-azidoanilino)acetic acid.
What is the SMILES notation for 2-(N-azidoanilino)acetic acid?
The canonical SMILES for 2-(N-azidoanilino)acetic acid is [N-]=[N+]=NN(CC(=O)O)c1ccccc1.
What is the InChIKey of 2-(N-azidoanilino)acetic acid?
The InChIKey is UIUNLAIBCNKSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c9-10-11-12(6-8(13)14)7-4-2-1-3-5-7/h1-5H,6H2,(H,13,14).
What are the key properties of 2-(N-azidoanilino)acetic acid?
2-(N-azidoanilino)acetic acid has a molecular weight of 192.18 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-azidoanilino)acetic acid is sourced from PubChem (CID 54355465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).