C14H11F17 — CID 54355597
1,1,1,2-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)non-3-ene (PubChem CID 54355597) has the molecular formula C14H11F17 and a molecular weight of 502.21 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)non-3-ene.
| Compound Name | 1,1,1,2-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)non-3-ene |
|---|---|
| PubChem CID | 54355597 |
| Molecular Formula | C14H11F17 |
| Molecular Weight | 502.21 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)non-3-ene |
| SMILES | CCCCCC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F17/c1-2-3-4-5-6(10(17,18)19)7(8(15,11(20,21)22)12(23,24)25)9(16,13(26,27)28)14(29,30)31/h2-5H2,1H3 |
| InChIKey | UIWSMNCTJWNSQX-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.21 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|