C24H28O11 — CID 54355664
3-[1,3-bis(2-methylprop-2-enoyloxy)propoxycarbonyl]-4-(2-methylprop-2-enoyloxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 54355664) has the molecular formula C24H28O11 and a molecular weight of 492.48 g/mol. Its IUPAC name is 3-[1,3-bis(2-methylprop-2-enoyloxy)propoxycarbonyl]-4-(2-methylprop-2-enoyloxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[1,3-bis(2-methylprop-2-enoyloxy)propoxycarbonyl]-4-(2-methylprop-2-enoyloxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54355664 |
| Molecular Formula | C24H28O11 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3-[1,3-bis(2-methylprop-2-enoyloxy)propoxycarbonyl]-4-(2-methylprop-2-enoyloxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C=C(C)C(=O)OCCC(OC(=O)C(=C)C)OC(=O)C1C(C(=O)O)C2C=CC1(COC(=O)C(=C)C)O2 |
| InChI | InChI=1S/C24H28O11/c1-12(2)20(27)31-10-8-16(33-22(29)14(5)6)34-23(30)18-17(19(25)26)15-7-9-24(18,35-15)11-32-21(28)13(3)4/h7,9,15-18H,1,3,5,8,10-11H2,2,4,6H3,(H,25,26) |
| InChIKey | UIXPOMYOHLAHHT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|