C28H40O5S — CID 54355841
[9-(benzenesulfonyl)-8-hydroxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate (PubChem CID 54355841) has the molecular formula C28H40O5S and a molecular weight of 488.69 g/mol. Its IUPAC name is [9-(benzenesulfonyl)-8-hydroxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate.
| Compound Name | [9-(benzenesulfonyl)-8-hydroxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 54355841 |
| Molecular Formula | C28H40O5S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [9-(benzenesulfonyl)-8-hydroxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
| SMILES | CC(=O)OCC=C(C)CCC=C(C)C(O)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H40O5S/c1-20(17-19-33-23(4)29)12-10-13-22(3)26(30)27(25-21(2)14-11-18-28(25,5)6)34(31,32)24-15-8-7-9-16-24/h7-9,13,15-17,26-27,30H,10-12,14,18-19H2,1-6H3 |
| InChIKey | UJAPZYWMXUQKFE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|