About 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine
3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine (PubChem CID 54356096) has the molecular formula C13H17F6NO2Si
and a molecular weight of 361.36 g/mol. Its IUPAC name is 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine |
| PubChem CID | 54356096 |
| Molecular Formula | C13H17F6NO2Si |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine |
| SMILES | NCCC[Si](OCC(F)(F)F)(OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H17F6NO2Si/c14-12(15,16)9-21-23(8-4-7-20,22-10-13(17,18)19)11-5-2-1-3-6-11/h1-3,5-6H,4,7-10,20H2 |
| InChIKey | UJERKJQFCXNHRA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine?
The IUPAC name of 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine (CID 54356096) is 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine.
What is the SMILES notation for 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine?
The canonical SMILES for 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine is NCCC[Si](OCC(F)(F)F)(OCC(F)(F)F)c1ccccc1.
What is the InChIKey of 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine?
The InChIKey is UJERKJQFCXNHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F6NO2Si/c14-12(15,16)9-21-23(8-4-7-20,22-10-13(17,18)19)11-5-2-1-3-6-11/h1-3,5-6H,4,7-10,20H2.
What are the key properties of 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine?
3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine has a molecular weight of 361.36 g/mol, XLogP of 2.84, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[phenyl-bis(2,2,2-trifluoroethoxy)silyl]propan-1-amine is sourced from PubChem (CID 54356096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).