About 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid
2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid (PubChem CID 54356139) has the molecular formula C21H23FN2O4
and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid.
Molecular Properties
| Compound Name | 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid |
| PubChem CID | 54356139 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid |
| SMILES | CCOc1cc(OCC)c(F)c(C(CC)(Nc2ccc(C#N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C21H23FN2O4/c1-4-21(20(25)26,24-15-9-7-14(13-23)8-10-15)17-11-16(27-5-2)12-18(19(17)22)28-6-3/h7-12,24H,4-6H2,1-3H3,(H,25,26) |
| InChIKey | UJFOCQGONPCMGD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid?
The IUPAC name of 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid (CID 54356139) is 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid.
What is the SMILES notation for 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid?
The canonical SMILES for 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid is CCOc1cc(OCC)c(F)c(C(CC)(Nc2ccc(C#N)cc2)C(=O)O)c1.
What is the InChIKey of 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid?
The InChIKey is UJFOCQGONPCMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2O4/c1-4-21(20(25)26,24-15-9-7-14(13-23)8-10-15)17-11-16(27-5-2)12-18(19(17)22)28-6-3/h7-12,24H,4-6H2,1-3H3,(H,25,26).
What are the key properties of 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid?
2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid has a molecular weight of 386.42 g/mol, XLogP of 4.30, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanoanilino)-2-(3,5-diethoxy-2-fluorophenyl)butanoic acid is sourced from PubChem (CID 54356139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).