About 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea
3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea (PubChem CID 54356698) has the molecular formula C16H19ClN2O3S
and a molecular weight of 354.86 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea |
| PubChem CID | 54356698 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NS(=O)(=O)C=C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-4-10-19(11-5-2)16(20)18-23(21,22)12-13(3)14-6-8-15(17)9-7-14/h4-9,12H,1-2,10-11H2,3H3,(H,18,20) |
| InChIKey | UJPGNIFBTCQLOA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea?
The IUPAC name of 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea (CID 54356698) is 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea.
What is the SMILES notation for 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea?
The canonical SMILES for 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea is C=CCN(CC=C)C(=O)NS(=O)(=O)C=C(C)c1ccc(Cl)cc1.
What is the InChIKey of 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea?
The InChIKey is UJPGNIFBTCQLOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O3S/c1-4-10-19(11-5-2)16(20)18-23(21,22)12-13(3)14-6-8-15(17)9-7-14/h4-9,12H,1-2,10-11H2,3H3,(H,18,20).
What are the key properties of 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea?
3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea has a molecular weight of 354.86 g/mol, XLogP of 3.41, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-chlorophenyl)prop-1-enylsulfonyl]-1,1-bis(prop-2-enyl)urea is sourced from PubChem (CID 54356698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).