About 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide
2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide (PubChem CID 54356772) has the molecular formula C6H8N4OS2
and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide |
| PubChem CID | 54356772 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide |
| SMILES | CON=C(C(N)=S)c1csc(N)n1 |
| InChI | InChI=1S/C6H8N4OS2/c1-11-10-4(5(7)12)3-2-13-6(8)9-3/h2H,1H3,(H2,7,12)(H2,8,9) |
| InChIKey | JSLOQOMQIMEBOK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide (CID 54356772) is 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide is CON=C(C(N)=S)c1csc(N)n1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide?
The InChIKey is JSLOQOMQIMEBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4OS2/c1-11-10-4(5(7)12)3-2-13-6(8)9-3/h2H,1H3,(H2,7,12)(H2,8,9).
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide?
2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide has a molecular weight of 216.29 g/mol, XLogP of 0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioamide is sourced from PubChem (CID 54356772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).