C44H42O10 — CID 54357092
ethyl 2-[3-[4-[3-(1-ethoxy-3-ethylperoxy-1-oxopropan-2-ylidene)-6-oxo-5-phenylcyclohexa-1,4-dien-1-yl]phenyl]-4-oxo-5-phenylcyclohexa-2,5-dien-1-ylidene]-3-ethylperoxypropanoate (PubChem CID 54357092) has the molecular formula C44H42O10 and a molecular weight of 730.81 g/mol. Its IUPAC name is ethyl 2-[3-[4-[3-(1-ethoxy-3-ethylperoxy-1-oxopropan-2-ylidene)-6-oxo-5-phenylcyclohexa-1,4-dien-1-yl]phenyl]-4-oxo-5-phenylcyclohexa-2,5-dien-1-ylidene]-3-ethylperoxypropanoate.
| Compound Name | ethyl 2-[3-[4-[3-(1-ethoxy-3-ethylperoxy-1-oxopropan-2-ylidene)-6-oxo-5-phenylcyclohexa-1,4-dien-1-yl]phenyl]-4-oxo-5-phenylcyclohexa-2,5-dien-1-ylidene]-3-ethylperoxypropanoate |
|---|---|
| PubChem CID | 54357092 |
| Molecular Formula | C44H42O10 |
| Molecular Weight | 730.81 g/mol |
| Exact Mass | 730.28 |
| IUPAC Name | ethyl 2-[3-[4-[3-(1-ethoxy-3-ethylperoxy-1-oxopropan-2-ylidene)-6-oxo-5-phenylcyclohexa-1,4-dien-1-yl]phenyl]-4-oxo-5-phenylcyclohexa-2,5-dien-1-ylidene]-3-ethylperoxypropanoate |
| SMILES | CCOOCC(C(=O)OCC)=C1C=C(c2ccccc2)C(=O)C(c2ccc(C3=CC(=C(COOCC)C(=O)OCC)C=C(c4ccccc4)C3=O)cc2)=C1 |
| InChI | InChI=1S/C44H42O10/c1-5-49-43(47)39(27-53-51-7-3)33-23-35(29-15-11-9-12-16-29)41(45)37(25-33)31-19-21-32(22-20-31)38-26-34(40(28-54-52-8-4)44(48)50-6-2)24-36(42(38)46)30-17-13-10-14-18-30/h9-26H,5-8,27-28H2,1-4H3 |
| InChIKey | UJVUAPMNAITUCR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|