C26H50O6 — CID 54357545
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-icos-11-en-8-yloxyoxane-3,4,5-triol (PubChem CID 54357545) has the molecular formula C26H50O6 and a molecular weight of 458.68 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-icos-11-en-8-yloxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-icos-11-en-8-yloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 54357545 |
| Molecular Formula | C26H50O6 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-icos-11-en-8-yloxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCC=CCCC(CCCCCCC)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H50O6/c1-3-5-7-9-10-11-12-13-15-17-19-21(18-16-14-8-6-4-2)31-26-25(30)24(29)23(28)22(20-27)32-26/h13,15,21-30H,3-12,14,16-20H2,1-2H3/t21?,22-,23-,24+,25-,26?/m1/s1 |
| InChIKey | UKDWYKKBWQRZKG-CWVZZBLFSA-N |
| XLogP | 4.62 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|