C19H16N4O3S — CID 5435758
N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-quinolin-8-ylsulfanylacetamide (PubChem CID 5435758) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-quinolin-8-ylsulfanylacetamide.
| Compound Name | N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-quinolin-8-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5435758 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-quinolin-8-ylsulfanylacetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)CSc2cccc3cccnc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O3S/c1-13-7-8-14(10-16(13)23(25)26)11-21-22-18(24)12-27-17-6-2-4-15-5-3-9-20-19(15)17/h2-11H,12H2,1H3,(H,22,24)/b21-11- |
| InChIKey | SMHKRUFKUCSDQK-NHDPSOOVSA-N |
| XLogP | 3.69 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|