C21H27NO4S — CID 54357755
3-[3-(6-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yloxy]-3-oxopropanoic acid (PubChem CID 54357755) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 3-[3-(6-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yloxy]-3-oxopropanoic acid.
| Compound Name | 3-[3-(6-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yloxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 54357755 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-[3-(6-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl)pentan-3-yloxy]-3-oxopropanoic acid |
| SMILES | CCC(CC)(OC(=O)CC(=O)O)C1CCc2c([nH]c3ccc(SC)cc23)C1 |
| InChI | InChI=1S/C21H27NO4S/c1-4-21(5-2,26-20(25)12-19(23)24)13-6-8-15-16-11-14(27-3)7-9-17(16)22-18(15)10-13/h7,9,11,13,22H,4-6,8,10,12H2,1-3H3,(H,23,24) |
| InChIKey | UKHWWSPSWKTCBG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|