C9H14N2 — CID 54357801
3,4,5,7,8,9-hexahydropyrido[1,2-b]diazepine (PubChem CID 54357801) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,4,5,7,8,9-hexahydropyrido[1,2-b]diazepine.
| Compound Name | 3,4,5,7,8,9-hexahydropyrido[1,2-b]diazepine |
|---|---|
| PubChem CID | 54357801 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3,4,5,7,8,9-hexahydropyrido[1,2-b]diazepine |
| SMILES | C1=NN2CCCC=C2CCC1 |
| InChI | InChI=1S/C9H14N2/c1-3-7-10-11-8-4-2-6-9(11)5-1/h6-7H,1-5,8H2 |
| InChIKey | UKIUESNOSHHFJC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |