C27H45N3O — CID 54358142
(3R,8S,9S,10R,13R,14S,17R)-3-azido-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one (PubChem CID 54358142) has the molecular formula C27H45N3O and a molecular weight of 427.68 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14S,17R)-3-azido-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | (3R,8S,9S,10R,13R,14S,17R)-3-azido-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 54358142 |
| Molecular Formula | C27H45N3O |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 427.36 |
| IUPAC Name | (3R,8S,9S,10R,13R,14S,17R)-3-azido-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)C4C[C@H](N=[N+]=[N-])CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H45N3O/c1-17(2)7-6-8-18(3)21-9-10-22-20-16-25(31)24-15-19(29-30-28)11-13-27(24,5)23(20)12-14-26(21,22)4/h17-24H,6-16H2,1-5H3/t18-,19-,20+,21-,22+,23+,24?,26-,27-/m1/s1 |
| InChIKey | UKOPCFVYHXMWOQ-ZNWQSTOPSA-N |
| XLogP | 7.97 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|