C32H18S8 — CID 54358216
2,3,4-trithiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene (PubChem CID 54358216) has the molecular formula C32H18S8 and a molecular weight of 659.03 g/mol. Its IUPAC name is 2,3,4-trithiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene.
| Compound Name | 2,3,4-trithiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 54358216 |
| Molecular Formula | C32H18S8 |
| Molecular Weight | 659.03 g/mol |
| Exact Mass | 657.92 |
| IUPAC Name | 2,3,4-trithiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene |
| SMILES | c1csc(-c2sc(-c3sc(-c4cccs4)c(-c4cccs4)c3-c3cccs3)c(-c3cccs3)c2-c2cccs2)c1 |
| InChI | InChI=1S/C32H18S8/c1-7-19(33-13-1)25-27(21-9-3-15-35-21)31(39-29(25)23-11-5-17-37-23)32-28(22-10-4-16-36-22)26(20-8-2-14-34-20)30(40-32)24-12-6-18-38-24/h1-18H |
| InChIKey | UKPXWKXYMMRTGO-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.03 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |