C18H20F3NOS2 — CID 54358775
2-[2-amino-5-(2-methyl-1,3-dithian-2-yl)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 54358775) has the molecular formula C18H20F3NOS2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[2-amino-5-(2-methyl-1,3-dithian-2-yl)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-[2-amino-5-(2-methyl-1,3-dithian-2-yl)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 54358775 |
| Molecular Formula | C18H20F3NOS2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[2-amino-5-(2-methyl-1,3-dithian-2-yl)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | CC1(c2ccc(N)c(C(O)(C#CC3CC3)C(F)(F)F)c2)SCCCS1 |
| InChI | InChI=1S/C18H20F3NOS2/c1-16(24-9-2-10-25-16)13-5-6-15(22)14(11-13)17(23,18(19,20)21)8-7-12-3-4-12/h5-6,11-12,23H,2-4,9-10,22H2,1H3 |
| InChIKey | UKZNRKFXQOCYBL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|