C13H13F3O4S2 — CID 54359055
2,2,2-trifluoro-1-[4-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylphenyl]ethanone (PubChem CID 54359055) has the molecular formula C13H13F3O4S2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylphenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylphenyl]ethanone |
|---|---|
| PubChem CID | 54359055 |
| Molecular Formula | C13H13F3O4S2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylphenyl]ethanone |
| SMILES | O=C(c1ccc(S[C@@H]2SC[C@@H](O)[C@H](O)[C@H]2O)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O4S2/c14-13(15,16)11(20)6-1-3-7(4-2-6)22-12-10(19)9(18)8(17)5-21-12/h1-4,8-10,12,17-19H,5H2/t8-,9+,10-,12+/m1/s1 |
| InChIKey | ULEDHFGTRIOYKQ-KLBPJQLPSA-N |
| XLogP | 1.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |