About prop-2-enyl quinoline-3-carboxylate
prop-2-enyl quinoline-3-carboxylate (PubChem CID 54359165) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is prop-2-enyl quinoline-3-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl quinoline-3-carboxylate |
| PubChem CID | 54359165 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | prop-2-enyl quinoline-3-carboxylate |
| SMILES | C=CCOC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C13H11NO2/c1-2-7-16-13(15)11-8-10-5-3-4-6-12(10)14-9-11/h2-6,8-9H,1,7H2 |
| InChIKey | ULGJEEBYIVWMHN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl quinoline-3-carboxylate?
The IUPAC name of prop-2-enyl quinoline-3-carboxylate (CID 54359165) is prop-2-enyl quinoline-3-carboxylate.
What is the SMILES notation for prop-2-enyl quinoline-3-carboxylate?
The canonical SMILES for prop-2-enyl quinoline-3-carboxylate is C=CCOC(=O)c1cnc2ccccc2c1.
What is the InChIKey of prop-2-enyl quinoline-3-carboxylate?
The InChIKey is ULGJEEBYIVWMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c1-2-7-16-13(15)11-8-10-5-3-4-6-12(10)14-9-11/h2-6,8-9H,1,7H2.
What are the key properties of prop-2-enyl quinoline-3-carboxylate?
prop-2-enyl quinoline-3-carboxylate has a molecular weight of 213.24 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl quinoline-3-carboxylate is sourced from PubChem (CID 54359165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).