About 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one
5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one (PubChem CID 54359182) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one.
Molecular Properties
| Compound Name | 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one |
| PubChem CID | 54359182 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C(C)=C(C)C(=O)N1C |
| InChI | InChI=1S/C10H9N3O/c1-6-7(2)10(14)13(5)8(6)9(11-3)12-4/h1-2,5H3 |
| InChIKey | ULGSGQBVLMFECM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one?
The IUPAC name of 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one (CID 54359182) is 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one.
What is the SMILES notation for 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one?
The canonical SMILES for 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one is [C-]#[N+]C([N+]#[C-])=C1C(C)=C(C)C(=O)N1C.
What is the InChIKey of 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one?
The InChIKey is ULGSGQBVLMFECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c1-6-7(2)10(14)13(5)8(6)9(11-3)12-4/h1-2,5H3.
What are the key properties of 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one?
5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one has a molecular weight of 187.20 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diisocyanomethylidene)-1,3,4-trimethylpyrrol-2-one is sourced from PubChem (CID 54359182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).