C6H9N5O3 — CID 54359625
2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethylurea (PubChem CID 54359625) has the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethylurea.
| Compound Name | 2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethylurea |
|---|---|
| PubChem CID | 54359625 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethylurea |
| SMILES | NC(=O)NCCn1cn[nH]c(=O)c1=O |
| InChI | InChI=1S/C6H9N5O3/c7-6(14)8-1-2-11-3-9-10-4(12)5(11)13/h3H,1-2H2,(H,10,12)(H3,7,8,14) |
| InChIKey | KEXBXYHAXHNRAE-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|