C12H25N2O2+ — CID 54360194
N-(1,1-dimethylpiperidin-1-ium-4-yl)-2-methoxy-2-methylpropanamide (PubChem CID 54360194) has the molecular formula C12H25N2O2+ and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(1,1-dimethylpiperidin-1-ium-4-yl)-2-methoxy-2-methylpropanamide.
| Compound Name | N-(1,1-dimethylpiperidin-1-ium-4-yl)-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 54360194 |
| Molecular Formula | C12H25N2O2+ |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | N-(1,1-dimethylpiperidin-1-ium-4-yl)-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)NC1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-12(2,16-5)11(15)13-10-6-8-14(3,4)9-7-10/h10H,6-9H2,1-5H3/p+1 |
| InChIKey | ULZFJALPRSUONY-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|