C19H20O3S — CID 54360854
2-[(4-ethylsulfanylphenyl)methyl]-4-oxo-4-phenylbutanoic acid (PubChem CID 54360854) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-[(4-ethylsulfanylphenyl)methyl]-4-oxo-4-phenylbutanoic acid.
| Compound Name | 2-[(4-ethylsulfanylphenyl)methyl]-4-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 54360854 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(4-ethylsulfanylphenyl)methyl]-4-oxo-4-phenylbutanoic acid |
| SMILES | CCSc1ccc(CC(CC(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H20O3S/c1-2-23-17-10-8-14(9-11-17)12-16(19(21)22)13-18(20)15-6-4-3-5-7-15/h3-11,16H,2,12-13H2,1H3,(H,21,22) |
| InChIKey | UMJPVHVFUZEDBQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |