C24H25BrN2 — CID 54361326
7-bromo-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 54361326) has the molecular formula C24H25BrN2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 7-bromo-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 7-bromo-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 54361326 |
| Molecular Formula | C24H25BrN2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 7-bromo-3-[(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Brc1ccc2c3c([nH]c2c1)CCC(CC1CC(c2ccccc2)=CCN1)C3 |
| InChI | InChI=1S/C24H25BrN2/c25-19-7-8-21-22-13-16(6-9-23(22)27-24(21)15-19)12-20-14-18(10-11-26-20)17-4-2-1-3-5-17/h1-5,7-8,10,15-16,20,26-27H,6,9,11-14H2 |
| InChIKey | UMSIVVVBPFWXDT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|