C28H34F2N2O5 — CID 54361804
tert-butyl N-[5-(benzylamino)-4,4-difluoro-3-hydroxy-5-oxo-1-[4-(5-oxopent-4-enyl)phenyl]pentan-2-yl]carbamate (PubChem CID 54361804) has the molecular formula C28H34F2N2O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is tert-butyl N-[5-(benzylamino)-4,4-difluoro-3-hydroxy-5-oxo-1-[4-(5-oxopent-4-enyl)phenyl]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(benzylamino)-4,4-difluoro-3-hydroxy-5-oxo-1-[4-(5-oxopent-4-enyl)phenyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 54361804 |
| Molecular Formula | C28H34F2N2O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | tert-butyl N-[5-(benzylamino)-4,4-difluoro-3-hydroxy-5-oxo-1-[4-(5-oxopent-4-enyl)phenyl]pentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(CCCC=C=O)cc1)C(O)C(F)(F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H34F2N2O5/c1-27(2,3)37-26(36)32-23(18-21-15-13-20(14-16-21)10-8-5-9-17-33)24(34)28(29,30)25(35)31-19-22-11-6-4-7-12-22/h4,6-7,9,11-16,23-24,34H,5,8,10,18-19H2,1-3H3,(H,31,35)(H,32,36) |
| InChIKey | UNALEBXXZAMKNA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|