About 1,2,2-tribromoadamantane
1,2,2-tribromoadamantane (PubChem CID 54362251) has the molecular formula C10H13Br3
and a molecular weight of 372.93 g/mol. Its IUPAC name is 1,2,2-tribromoadamantane.
Molecular Properties
| Compound Name | 1,2,2-tribromoadamantane |
| PubChem CID | 54362251 |
| Molecular Formula | C10H13Br3 |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 369.86 |
| IUPAC Name | 1,2,2-tribromoadamantane |
| SMILES | BrC12CC3CC(CC(C3)C1(Br)Br)C2 |
| InChI | InChI=1S/C10H13Br3/c11-9-4-6-1-7(5-9)3-8(2-6)10(9,12)13/h6-8H,1-5H2 |
| InChIKey | UNHZYUSTXMPGKZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-tribromoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-tribromoadamantane?
The IUPAC name of 1,2,2-tribromoadamantane (CID 54362251) is 1,2,2-tribromoadamantane.
What is the SMILES notation for 1,2,2-tribromoadamantane?
The canonical SMILES for 1,2,2-tribromoadamantane is BrC12CC3CC(CC(C3)C1(Br)Br)C2.
What is the InChIKey of 1,2,2-tribromoadamantane?
The InChIKey is UNHZYUSTXMPGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Br3/c11-9-4-6-1-7(5-9)3-8(2-6)10(9,12)13/h6-8H,1-5H2.
What are the key properties of 1,2,2-tribromoadamantane?
1,2,2-tribromoadamantane has a molecular weight of 372.93 g/mol, XLogP of 4.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-tribromoadamantane is sourced from PubChem (CID 54362251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).