C23H28O8 — CID 54362918
1-(9-butyl-5,7,12,14-tetraoxo-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),4(8)-dien-2-yl)pentyl acetate (PubChem CID 54362918) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-(9-butyl-5,7,12,14-tetraoxo-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),4(8)-dien-2-yl)pentyl acetate.
| Compound Name | 1-(9-butyl-5,7,12,14-tetraoxo-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),4(8)-dien-2-yl)pentyl acetate |
|---|---|
| PubChem CID | 54362918 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-(9-butyl-5,7,12,14-tetraoxo-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),4(8)-dien-2-yl)pentyl acetate |
| SMILES | CCCCC1CC2=C(C(=O)OC2=O)C(C(CCCC)OC(C)=O)CC2=C1C(=O)OC2=O |
| InChI | InChI=1S/C23H28O8/c1-4-6-8-13-10-15-19(23(28)31-20(15)25)14(17(9-7-5-2)29-12(3)24)11-16-18(13)22(27)30-21(16)26/h13-14,17H,4-11H2,1-3H3 |
| InChIKey | UNTJKPBNBQYGSB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|