C21H30O4 — CID 54362927
2-[3-(2-methoxy-5-oxo-2H-furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal (PubChem CID 54362927) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[3-(2-methoxy-5-oxo-2H-furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal.
| Compound Name | 2-[3-(2-methoxy-5-oxo-2H-furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal |
|---|---|
| PubChem CID | 54362927 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[3-(2-methoxy-5-oxo-2H-furan-3-yl)propylidene]-6,10-dimethylundeca-5,9-dienal |
| SMILES | COC1OC(=O)C=C1CCC=C(C=O)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C21H30O4/c1-16(2)8-5-9-17(3)10-6-11-18(15-22)12-7-13-19-14-20(23)25-21(19)24-4/h8,10,12,14-15,21H,5-7,9,11,13H2,1-4H3 |
| InChIKey | UNTNBWGFXHJYHY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|