C63H72NO7P — CID 54363544
[(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] icosa-5,8,11,14-tetraenoate (PubChem CID 54363544) has the molecular formula C63H72NO7P and a molecular weight of 986.24 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 54363544 |
| Molecular Formula | C63H72NO7P |
| Molecular Weight | 986.24 g/mol |
| Exact Mass | 985.50 |
| IUPAC Name | [(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)COP(=O)(O)OCCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C63H72NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-36-49-61(65)71-60(52-68-63(57-43-30-21-31-44-57,58-45-32-22-33-46-58)59-47-34-23-35-48-59)53-70-72(66,67)69-51-50-64-62(54-37-24-18-25-38-54,55-39-26-19-27-40-55)56-41-28-20-29-42-56/h6-7,9-10,12-13,15-16,18-35,37-48,60,64H,2-5,8,11,14,17,36,49-53H2,1H3,(H,66,67)/t60-/m1/s1 |
| InChIKey | UOEKPXGGRGSDCQ-AKAJXFOGSA-N |
| XLogP | 14.77 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.24 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|