About chloro-methyl-bis(3,3,3-trifluoropropyl)silane
chloro-methyl-bis(3,3,3-trifluoropropyl)silane (PubChem CID 54363741) has the molecular formula C7H11ClF6Si
and a molecular weight of 272.69 g/mol. Its IUPAC name is chloro-methyl-bis(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | chloro-methyl-bis(3,3,3-trifluoropropyl)silane |
| PubChem CID | 54363741 |
| Molecular Formula | C7H11ClF6Si |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | chloro-methyl-bis(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](Cl)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C7H11ClF6Si/c1-15(8,4-2-6(9,10)11)5-3-7(12,13)14/h2-5H2,1H3 |
| InChIKey | UOHSGEWFJKPXJP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-methyl-bis(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-methyl-bis(3,3,3-trifluoropropyl)silane?
The IUPAC name of chloro-methyl-bis(3,3,3-trifluoropropyl)silane (CID 54363741) is chloro-methyl-bis(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for chloro-methyl-bis(3,3,3-trifluoropropyl)silane?
The canonical SMILES for chloro-methyl-bis(3,3,3-trifluoropropyl)silane is C[Si](Cl)(CCC(F)(F)F)CCC(F)(F)F.
What is the InChIKey of chloro-methyl-bis(3,3,3-trifluoropropyl)silane?
The InChIKey is UOHSGEWFJKPXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClF6Si/c1-15(8,4-2-6(9,10)11)5-3-7(12,13)14/h2-5H2,1H3.
What are the key properties of chloro-methyl-bis(3,3,3-trifluoropropyl)silane?
chloro-methyl-bis(3,3,3-trifluoropropyl)silane has a molecular weight of 272.69 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-methyl-bis(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 54363741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).