C22H42O7 — CID 54363967
(2S,3R,4S,5R)-3,4,5-trihydroxy-6-octoxy-6-octyloxane-2-carboxylic acid (PubChem CID 54363967) has the molecular formula C22H42O7 and a molecular weight of 418.57 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3,4,5-trihydroxy-6-octoxy-6-octyloxane-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5R)-3,4,5-trihydroxy-6-octoxy-6-octyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 54363967 |
| Molecular Formula | C22H42O7 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (2S,3R,4S,5R)-3,4,5-trihydroxy-6-octoxy-6-octyloxane-2-carboxylic acid |
| SMILES | CCCCCCCCOC1(CCCCCCCC)O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H42O7/c1-3-5-7-9-11-13-15-22(28-16-14-12-10-8-6-4-2)20(25)18(24)17(23)19(29-22)21(26)27/h17-20,23-25H,3-16H2,1-2H3,(H,26,27)/t17-,18+,19+,20-,22?/m1/s1 |
| InChIKey | UOLQPAURRZWMCP-RGDJTVPYSA-N |
| XLogP | 3.38 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|