C19H31NO5 — CID 54363972
diethyl 3-butyl-5-methyl-7-oxo-2,3,5,6,8,8a-hexahydro-1H-indolizine-6,8-dicarboxylate (PubChem CID 54363972) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is diethyl 3-butyl-5-methyl-7-oxo-2,3,5,6,8,8a-hexahydro-1H-indolizine-6,8-dicarboxylate.
| Compound Name | diethyl 3-butyl-5-methyl-7-oxo-2,3,5,6,8,8a-hexahydro-1H-indolizine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 54363972 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | diethyl 3-butyl-5-methyl-7-oxo-2,3,5,6,8,8a-hexahydro-1H-indolizine-6,8-dicarboxylate |
| SMILES | CCCCC1CCC2C(C(=O)OCC)C(=O)C(C(=O)OCC)C(C)N12 |
| InChI | InChI=1S/C19H31NO5/c1-5-8-9-13-10-11-14-16(19(23)25-7-3)17(21)15(12(4)20(13)14)18(22)24-6-2/h12-16H,5-11H2,1-4H3 |
| InChIKey | UOLUEVFOLCKWQJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|