C21H23F3N2O2 — CID 54364183
methyl 6-[1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindazol-3-yl]hex-5-enoate (PubChem CID 54364183) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is methyl 6-[1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindazol-3-yl]hex-5-enoate.
| Compound Name | methyl 6-[1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindazol-3-yl]hex-5-enoate |
|---|---|
| PubChem CID | 54364183 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | methyl 6-[1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindazol-3-yl]hex-5-enoate |
| SMILES | COC(=O)CCCC=Cc1nn(-c2cccc(C(F)(F)F)c2)c2c1CCCC2 |
| InChI | InChI=1S/C21H23F3N2O2/c1-28-20(27)13-4-2-3-11-18-17-10-5-6-12-19(17)26(25-18)16-9-7-8-15(14-16)21(22,23)24/h3,7-9,11,14H,2,4-6,10,12-13H2,1H3 |
| InChIKey | UOPIZPCVBUAXBA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|