About 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine
2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine (PubChem CID 54364348) has the molecular formula C11H23N5
and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine |
| PubChem CID | 54364348 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine |
| SMILES | NC1CN=C(NCCCN2CCCCC2)N1 |
| InChI | InChI=1S/C11H23N5/c12-10-9-14-11(15-10)13-5-4-8-16-6-2-1-3-7-16/h10H,1-9,12H2,(H2,13,14,15) |
| InChIKey | UOSSEDKYIDSNHP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine?
The IUPAC name of 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine (CID 54364348) is 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine.
What is the SMILES notation for 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine?
The canonical SMILES for 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine is NC1CN=C(NCCCN2CCCCC2)N1.
What is the InChIKey of 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine?
The InChIKey is UOSSEDKYIDSNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N5/c12-10-9-14-11(15-10)13-5-4-8-16-6-2-1-3-7-16/h10H,1-9,12H2,(H2,13,14,15).
What are the key properties of 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine?
2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine has a molecular weight of 225.34 g/mol, XLogP of -0.30, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1H-imidazole-2,5-diamine is sourced from PubChem (CID 54364348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).