N-butyl-N-propylsulfamoyl fluoride

C7H16FNO2S — CID 54364385

IUPACN-butyl-N-propylsulfamoyl fluoride
SMILESCCCCN(CCC)S(=O)(=O)F
InChIInChI=1S/C7H16FNO2S/c1-3-5-7-9(6-4-2)12(8,10)11/h3-7H2,1-2H3
InChIKeyUOTGZVCNRHTYPU-UHFFFAOYSA-N
MW197.27 g/mol
LogP1.71
Rot. Bonds6

About N-butyl-N-propylsulfamoyl fluoride

N-butyl-N-propylsulfamoyl fluoride (PubChem CID 54364385) has the molecular formula C7H16FNO2S and a molecular weight of 197.27 g/mol. Its IUPAC name is N-butyl-N-propylsulfamoyl fluoride.

Molecular Properties

Compound NameN-butyl-N-propylsulfamoyl fluoride
PubChem CID54364385
Molecular FormulaC7H16FNO2S
Molecular Weight197.27 g/mol
Exact Mass197.09
IUPAC NameN-butyl-N-propylsulfamoyl fluoride
SMILESCCCCN(CCC)S(=O)(=O)F
InChIInChI=1S/C7H16FNO2S/c1-3-5-7-9(6-4-2)12(8,10)11/h3-7H2,1-2H3
InChIKeyUOTGZVCNRHTYPU-UHFFFAOYSA-N
XLogP1.71
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.27
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-butyl-N-propylsulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-butyl-N-propylsulfamoyl fluoride?
The IUPAC name of N-butyl-N-propylsulfamoyl fluoride (CID 54364385) is N-butyl-N-propylsulfamoyl fluoride.
What is the SMILES notation for N-butyl-N-propylsulfamoyl fluoride?
The canonical SMILES for N-butyl-N-propylsulfamoyl fluoride is CCCCN(CCC)S(=O)(=O)F.
What is the InChIKey of N-butyl-N-propylsulfamoyl fluoride?
The InChIKey is UOTGZVCNRHTYPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16FNO2S/c1-3-5-7-9(6-4-2)12(8,10)11/h3-7H2,1-2H3.
What are the key properties of N-butyl-N-propylsulfamoyl fluoride?
N-butyl-N-propylsulfamoyl fluoride has a molecular weight of 197.27 g/mol, XLogP of 1.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-propylsulfamoyl fluoride is sourced from PubChem (CID 54364385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).