C14H24F6O2S — CID 54364787
1,1,1-trifluoro-2-(1,1,1-trifluoroheptan-2-ylsulfonyl)heptane (PubChem CID 54364787) has the molecular formula C14H24F6O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1,1,1-trifluoroheptan-2-ylsulfonyl)heptane.
| Compound Name | 1,1,1-trifluoro-2-(1,1,1-trifluoroheptan-2-ylsulfonyl)heptane |
|---|---|
| PubChem CID | 54364787 |
| Molecular Formula | C14H24F6O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1,1,1-trifluoro-2-(1,1,1-trifluoroheptan-2-ylsulfonyl)heptane |
| SMILES | CCCCCC(C(F)(F)F)S(=O)(=O)C(CCCCC)C(F)(F)F |
| InChI | InChI=1S/C14H24F6O2S/c1-3-5-7-9-11(13(15,16)17)23(21,22)12(14(18,19)20)10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | UPALXPYDFVSUEL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|