C27H35N3O4 — CID 54364843
(2S)-2-[2,5-dihydroxy-3-[2-[4-(hydroxyamino)phenyl]propyl]pyrrol-1-yl]-4-methyl-N-(2-phenylethyl)pentanamide (PubChem CID 54364843) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is (2S)-2-[2,5-dihydroxy-3-[2-[4-(hydroxyamino)phenyl]propyl]pyrrol-1-yl]-4-methyl-N-(2-phenylethyl)pentanamide.
| Compound Name | (2S)-2-[2,5-dihydroxy-3-[2-[4-(hydroxyamino)phenyl]propyl]pyrrol-1-yl]-4-methyl-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 54364843 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (2S)-2-[2,5-dihydroxy-3-[2-[4-(hydroxyamino)phenyl]propyl]pyrrol-1-yl]-4-methyl-N-(2-phenylethyl)pentanamide |
| SMILES | CC(C)C[C@@H](C(=O)NCCc1ccccc1)n1c(O)cc(CC(C)c2ccc(NO)cc2)c1O |
| InChI | InChI=1S/C27H35N3O4/c1-18(2)15-24(26(32)28-14-13-20-7-5-4-6-8-20)30-25(31)17-22(27(30)33)16-19(3)21-9-11-23(29-34)12-10-21/h4-12,17-19,24,29,31,33-34H,13-16H2,1-3H3,(H,28,32)/t19?,24-/m0/s1 |
| InChIKey | UPBLQWQDLFFFQJ-WIIYFNMSSA-N |
| XLogP | 4.99 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|