C11H16N2O3 — CID 54364864
1-acetyl-7-(methylamino)-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione (PubChem CID 54364864) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-acetyl-7-(methylamino)-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione.
| Compound Name | 1-acetyl-7-(methylamino)-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione |
|---|---|
| PubChem CID | 54364864 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-acetyl-7-(methylamino)-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione |
| SMILES | CNC1CC(=O)N2CCC(C(C)=O)C2C1=O |
| InChI | InChI=1S/C11H16N2O3/c1-6(14)7-3-4-13-9(15)5-8(12-2)11(16)10(7)13/h7-8,10,12H,3-5H2,1-2H3 |
| InChIKey | UPBVPRQJYDMQRW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |