C33H40O5S — CID 54365605
methyl (2S,3R)-2-hydroxy-3-(2-methoxy-2-oxo-1-phenylethyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate (PubChem CID 54365605) has the molecular formula C33H40O5S and a molecular weight of 548.75 g/mol. Its IUPAC name is methyl (2S,3R)-2-hydroxy-3-(2-methoxy-2-oxo-1-phenylethyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate.
| Compound Name | methyl (2S,3R)-2-hydroxy-3-(2-methoxy-2-oxo-1-phenylethyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate |
|---|---|
| PubChem CID | 54365605 |
| Molecular Formula | C33H40O5S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | methyl (2S,3R)-2-hydroxy-3-(2-methoxy-2-oxo-1-phenylethyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate |
| SMILES | COC(=O)C(S[C@H](c1ccccc1CCCCCCCCc1ccccc1)[C@@H](O)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C33H40O5S/c1-37-32(35)29(34)31(39-30(33(36)38-2)27-22-13-8-14-23-27)28-24-16-15-21-26(28)20-12-6-4-3-5-9-17-25-18-10-7-11-19-25/h7-8,10-11,13-16,18-19,21-24,29-31,34H,3-6,9,12,17,20H2,1-2H3/t29-,30?,31-/m1/s1 |
| InChIKey | UPOAVSXUIDRLMB-SAMCCIRTSA-N |
| XLogP | 7.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|