About N-(1,3,4-trihydroxybutan-2-yl)formamide
N-(1,3,4-trihydroxybutan-2-yl)formamide (PubChem CID 54365675) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is N-(1,3,4-trihydroxybutan-2-yl)formamide.
Molecular Properties
| Compound Name | N-(1,3,4-trihydroxybutan-2-yl)formamide |
| PubChem CID | 54365675 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | N-(1,3,4-trihydroxybutan-2-yl)formamide |
| SMILES | O=CNC(CO)C(O)CO |
| InChI | InChI=1S/C5H11NO4/c7-1-4(6-3-9)5(10)2-8/h3-5,7-8,10H,1-2H2,(H,6,9) |
| InChIKey | QAMUCHVOWSVLHO-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3,4-trihydroxybutan-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3,4-trihydroxybutan-2-yl)formamide?
The IUPAC name of N-(1,3,4-trihydroxybutan-2-yl)formamide (CID 54365675) is N-(1,3,4-trihydroxybutan-2-yl)formamide.
What is the SMILES notation for N-(1,3,4-trihydroxybutan-2-yl)formamide?
The canonical SMILES for N-(1,3,4-trihydroxybutan-2-yl)formamide is O=CNC(CO)C(O)CO.
What is the InChIKey of N-(1,3,4-trihydroxybutan-2-yl)formamide?
The InChIKey is QAMUCHVOWSVLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4/c7-1-4(6-3-9)5(10)2-8/h3-5,7-8,10H,1-2H2,(H,6,9).
What are the key properties of N-(1,3,4-trihydroxybutan-2-yl)formamide?
N-(1,3,4-trihydroxybutan-2-yl)formamide has a molecular weight of 149.15 g/mol, XLogP of -2.55, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3,4-trihydroxybutan-2-yl)formamide is sourced from PubChem (CID 54365675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).